cas: 200184-87-8 — see every product listed under this CAS number, including other names
cis-1-(tert-Butoxycarbonyl)-4-methoxypyrrolidine-2-carboxylic acid, 98%, 98% (CAS 200184-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CLA-5g |
| cas | 200184-87-8 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2709.20 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 765.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,4R)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 200184-87-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,4R)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: COHIMMPWCAHSFN-HTQZYQBOSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,4R)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | COHIMMPWCAHSFN-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1C(=O)O)OC |
Computed by PubChem (NCBI)