cas: 1187927-05-4 — see every product listed under this CAS number, including other names
cis-2-Phenyl-pyrrolidine-3-carboxylic acid hydrochloride, 97%, 97% (CAS 1187927-05-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103ME-100mg |
| cas | 1187927-05-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1946.00 Pln | |
| Chemat | 250mg | 2574.80 Pln | |
| Chemat | 500mg | 4250.00 Pln | |
| Chemat | 1g | 6338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-2-phenylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1187927-05-4) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (2R,3S)-2-phenylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: CLBXHARXLYHVIZ-IYPAPVHQSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (2R,3S)-2-phenylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | CLBXHARXLYHVIZ-IYPAPVHQSA-N |
| SMILES | C1CN[C@H]([C@H]1C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)