Products 446053-47-0

CAS 446053-47-0 is the registry number for 4-Amino-3-(4-chloro-phenyl)-butyric acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-(4-chlorophenyl)butanoate (CAS 446053-47-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 4-amino-3-(4-chlorophenyl)butanoate. InChIKey: WWCYOWKGBSCUIA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2
Molecular weight227.69 g/mol
IUPAC namemethyl 4-amino-3-(4-chlorophenyl)butanoate
InChIKeyWWCYOWKGBSCUIA-UHFFFAOYSA-N
SMILESCOC(=O)CC(CN)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)