cas: 156469-74-8 — see every product listed under this CAS number, including other names
cis-Diethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 95+% (CAS 156469-74-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A743190-100mg |
| cas | 156469-74-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1339.45 Pln | |
| AmBeed | 10g | 25322.29 Pln | |
| AmBeed | 5g | 15225.28 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Diethyl (3S,4R)-1-benzylpyrrolidine-3,4-dicarboxylate (CAS 156469-74-8) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: diethyl (3S,4R)-1-benzylpyrrolidine-3,4-dicarboxylate. InChIKey: QXELSODIWMVNCI-GASCZTMLSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | diethyl (3S,4R)-1-benzylpyrrolidine-3,4-dicarboxylate |
| InChIKey | QXELSODIWMVNCI-GASCZTMLSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@@H]1C(=O)OCC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)