Products 186203-24-7

CAS 186203-24-7 is the registry number for Diethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 1-benzylpyrrolidine-3,4-dicarboxylate (CAS 186203-24-7) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: diethyl 1-benzylpyrrolidine-3,4-dicarboxylate. InChIKey: QXELSODIWMVNCI-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO4
Molecular weight305.4 g/mol
IUPAC namediethyl 1-benzylpyrrolidine-3,4-dicarboxylate
InChIKeyQXELSODIWMVNCI-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC1C(=O)OCC)CC2=CC=CC=C2

Computed by PubChem (NCBI)