cas: 76272-56-5 — see every product listed under this CAS number, including other names
endo-3-Amine-9-methyl-9-azabicyclo[3,3,1]nonane, 98%, 98% (CAS 76272-56-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145TC-100mg |
| cas | 76272-56-5 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 506.00 Pln | |
| Chemat | 25g | 1173.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine (CAS 76272-56-5) is a chemical compound with the molecular formula C9H18N2 and a molecular weight of 154.25 g/mol. IUPAC name: (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. InChIKey: HTZWHTQVHWHSHN-CBLAIPOGSA-N.
| Molecular formula | C9H18N2 |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine |
| InChIKey | HTZWHTQVHWHSHN-CBLAIPOGSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)