CAS 76272-41-8 appears in our catalog under these names: Exo-3-amino-9-methyl-9-azabicyclo[3,3,1]nonane, 95%, exo–3–Amino–9–methyl–9–azabicyclo(3,3,1)nonane, exo-3-Amino-9-methyl-9-azabicyclo[3,3,1]nonane 96%, (3-exo)-9-Methyl-9-azabicyclo[3.3.1]nonan-3-amine, >95%, >95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine (CAS 76272-41-8) is a chemical compound with the molecular formula C9H18N2 and a molecular weight of 154.25 g/mol. IUPAC name: (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine. InChIKey: HTZWHTQVHWHSHN-CBLAIPOGSA-N.
| Molecular formula | C9H18N2 |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine |
| InChIKey | HTZWHTQVHWHSHN-CBLAIPOGSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)