cas: 180468-41-1 — see every product listed under this CAS number, including other names
ethyl (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate, 98%, 98% (CAS 180468-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABFW-100mg |
| cas | 180468-41-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 453.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 180468-41-1) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: ethyl (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: DKKVDRQVNMALLN-QGZVFWFLSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | ethyl (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | DKKVDRQVNMALLN-QGZVFWFLSA-N |
| SMILES | CCOC(=O)N1CCC2=CC=CC=C2[C@H]1C3=CC=CC=C3 |
Computed by PubChem (NCBI)