cas: 958332-97-3 — see every product listed under this CAS number, including other names
ethyl 4-broMoquinoline-6-carboxylate, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 958332-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJGR-100mg |
| cas | 958332-97-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 582.80 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-bromoquinoline-6-carboxylate (CAS 958332-97-3) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: ethyl 4-bromoquinoline-6-carboxylate. InChIKey: YSIDFEJBSYYMDZ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | ethyl 4-bromoquinoline-6-carboxylate |
| InChIKey | YSIDFEJBSYYMDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CN=C2C=C1)Br |
Computed by PubChem (NCBI)