cas: 86210-92-6 — see every product listed under this CAS number, including other names
ethyl 6-methoxy-2-methylquinoline-3-carboxylate, 98% (CAS 86210-92-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F370163-100MG |
| cas | 86210-92-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3736.20 Pln | |
| Fluorochem | 10g | 7130.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-methoxy-2-methylquinoline-3-carboxylate (CAS 86210-92-6) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: ethyl 6-methoxy-2-methylquinoline-3-carboxylate. InChIKey: DOOZEQYEQPQCGX-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | ethyl 6-methoxy-2-methylquinoline-3-carboxylate |
| InChIKey | DOOZEQYEQPQCGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)OC)C |
Computed by PubChem (NCBI)