cas: 117088-31-0 — see every product listed under this CAS number, including other names
fmoc-thr(tbu)-opfp, 95% (CAS 117088-31-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F045497-250MG |
| cas | 117088-31-0 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 992.38 Pln | |
| Fluorochem | 25g | 3132.25 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1477.31 Pln | |
| Ambeed | 25g | 4992.81 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate (CAS 117088-31-0) is a chemical compound with the molecular formula C29H26F5NO5 and a molecular weight of 563.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate. InChIKey: BHUUPIXJXWQAMT-PWECECGKSA-N.
| Molecular formula | C29H26F5NO5 |
|---|---|
| Molecular weight | 563.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
| InChIKey | BHUUPIXJXWQAMT-PWECECGKSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC(C)(C)C |
Computed by PubChem (NCBI)