CAS 2878477-18-8 appears in our catalog under these names: hCAII-IN-9, 98%, hCAII-IN-9/ 98.63% (existing batch purity), hCAII-IN-9. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 500mg, 200mg.
N-(5-chloro-2,4-disulfamoylphenyl)-3,5-dimethylbenzamide (CAS 2878477-18-8) is a chemical compound with the molecular formula C15H16ClN3O5S2 and a molecular weight of 417.9 g/mol. IUPAC name: N-(5-chloro-2,4-disulfamoylphenyl)-3,5-dimethylbenzamide. InChIKey: UPGBBLHZTSGOHJ-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O5S2 |
|---|---|
| Molecular weight | 417.9 g/mol |
| IUPAC name | N-(5-chloro-2,4-disulfamoylphenyl)-3,5-dimethylbenzamide |
| InChIKey | UPGBBLHZTSGOHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)NC2=CC(=C(C=C2S(=O)(=O)N)S(=O)(=O)N)Cl)C |
Computed by PubChem (NCBI)