CAS 24900-61-6 appears in our catalog under these names: hPL-IN-2/ 98.75% (existing batch purity), hPL–IN–2, hPL-IN-2 98%, hPL-IN-2, 98.17%, 3,5-Dichloro-N-(3-chloro-4-(4-chlorophenoxy)phenyl)-2-hydroxybenzamide, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
3,5-dichloro-N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxybenzamide (CAS 24900-61-6) is a chemical compound with the molecular formula C19H11Cl4NO3 and a molecular weight of 443.1 g/mol. IUPAC name: 3,5-dichloro-N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxybenzamide. InChIKey: HPIKHGXRCDJEKT-UHFFFAOYSA-N.
| Molecular formula | C19H11Cl4NO3 |
|---|---|
| Molecular weight | 443.1 g/mol |
| IUPAC name | 3,5-dichloro-N-[3-chloro-4-(4-chlorophenoxy)phenyl]-2-hydroxybenzamide |
| InChIKey | HPIKHGXRCDJEKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)NC(=O)C3=C(C(=CC(=C3)Cl)Cl)O)Cl)Cl |
Computed by PubChem (NCBI)