CAS 881970-80-5 appears in our catalog under these names: iMDK, iMDK/ 99.77% (existing batch purity), iMDK 97%, 3-{2-[(4-fluorophenyl)methyl]imidazo[2,1-b][1,3]thiazol-6-yl}-2H-chromen-2-one, iMDK, 99.35%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 1mg, 5mg, 25mg, 100mg, 500mg, 250mg.
3-[2-[(4-fluorophenyl)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]chromen-2-one (CAS 881970-80-5) is a chemical compound with the molecular formula C21H13FN2O2S and a molecular weight of 376.4 g/mol. IUPAC name: 3-[2-[(4-fluorophenyl)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]chromen-2-one. InChIKey: IWFKQTWYILKFGE-UHFFFAOYSA-N.
| Molecular formula | C21H13FN2O2S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 3-[2-[(4-fluorophenyl)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]chromen-2-one |
| InChIKey | IWFKQTWYILKFGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C3=CN4C=C(SC4=N3)CC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)