cas: 124729-98-2 — see every product listed under this CAS number, including other names
m-MTDATA 95% (CAS 124729-98-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466068-250mg |
| cas | 124729-98-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1082.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A466068 |
4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine (CAS 124729-98-2) is a chemical compound with the molecular formula C57H48N4 and a molecular weight of 789.0 g/mol. IUPAC name: 4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine. InChIKey: DIVZFUBWFAOMCW-UHFFFAOYSA-N.
| Molecular formula | C57H48N4 |
|---|---|
| Molecular weight | 789.0 g/mol |
| IUPAC name | 4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine |
| InChIKey | DIVZFUBWFAOMCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC(=C6)C)C7=CC=C(C=C7)N(C8=CC=CC=C8)C9=CC=CC(=C9)C |
Computed by PubChem (NCBI)