m-PEG10-CH2COOH 95%
cas: 908258-58-2 — see every product listed under this CAS number, including other names
m-PEG10-CH2COOH 95% (CAS 908258-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A654108-100mg |
| cas | 908258-58-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 1149.12 Pln | |
| Ambeed | 5g | 5460.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A654108 |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 908258-58-2) is a chemical compound with the molecular formula C23H46O13 and a molecular weight of 530.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: DNJQYLLQMMESPG-UHFFFAOYSA-N.
| Molecular formula | C23H46O13 |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | DNJQYLLQMMESPG-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)