cas: 2280998-74-3 — see every product listed under this CAS number, including other names
m-PEG11-acid, 98% (CAS 2280998-74-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554745-50MG |
| cas | 2280998-74-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 476.93 Pln | |
| Fluorochem | 100mg | 737.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2280998-74-3) is a chemical compound with the molecular formula C24H48O13 and a molecular weight of 544.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: XTRVAOVFCQZNBJ-UHFFFAOYSA-N.
| Molecular formula | C24H48O13 |
|---|---|
| Molecular weight | 544.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | XTRVAOVFCQZNBJ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)