CAS 2280998-74-3 appears in our catalog under these names: m-PEG11-acid, 95%, m-PEG11-acid, m–PEG11–acid, m-PEG11-acid 98%, m-PEG11-acid, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 5mg, 10mg, 100mg, 50mg, 100 mg.
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2280998-74-3) is a chemical compound with the molecular formula C24H48O13 and a molecular weight of 544.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: XTRVAOVFCQZNBJ-UHFFFAOYSA-N.
| Molecular formula | C24H48O13 |
|---|---|
| Molecular weight | 544.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | XTRVAOVFCQZNBJ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)