m-PEG8-NHS ester 98%
cas: 756525-90-3 — see every product listed under this CAS number, including other names
m-PEG8-NHS ester 98% (CAS 756525-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A703316-100mg |
| cas | 756525-90-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2428.50 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A703316 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756525-90-3) is a chemical compound with the molecular formula C22H39NO12 and a molecular weight of 509.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IBZNTYBFTKFSMU-UHFFFAOYSA-N.
| Molecular formula | C22H39NO12 |
|---|---|
| Molecular weight | 509.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IBZNTYBFTKFSMU-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)
Synonyms:
1-((26-Oxo-2,5,8,11,14,17,20,23-octaoxahexacosan-26-yl)oxy)pyrrolidine-2,5-dione, 1-[(26-Oxo-2,5,8,11,14,17,20,23-octaoxahexacosan-26-yl)oxy]pyrrolidine-2,5-dione, m-PEG8-NHS ester, MeO-dPEG(8)-NHS, Methyl-PEG8-NHS Ester, mPEG7-CH2CH2COONHS Ester, mPEG7-SPA, mPEG7-CH2CH2COONHS, 4,7,10,13,16,19,22,25-Octaoxahexacosanoic acid, 2,5-dioxo-1-pyrrolidinyl ester, 2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic acid succinimidyl ester