m-PEG8-NHS ester, 99.94%
cas: 756525-90-3 — see every product listed under this CAS number, including other names
m-PEG8-NHS ester, 99.94% (CAS 756525-90-3) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 50 mg, 1 g, 5 g, 250 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W019793-10 g |
| cas | 756525-90-3 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 4294.96 Pln | |
| MedChemExpress | 25 g | 8469.91 Pln | |
| MedChemExpress | 50 mg | 361.49 Pln | |
| MedChemExpress | 1 g | 983.78 Pln | |
| MedChemExpress | 5 g | 2711.35 Pln | |
| MedChemExpress | 250 mg | 551.89 Pln | |
| MedChemExpress | 100 mg | 477.59 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756525-90-3) is a chemical compound with the molecular formula C22H39NO12 and a molecular weight of 509.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IBZNTYBFTKFSMU-UHFFFAOYSA-N.
| Molecular formula | C22H39NO12 |
|---|---|
| Molecular weight | 509.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IBZNTYBFTKFSMU-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)
Synonyms:
1-((26-Oxo-2,5,8,11,14,17,20,23-octaoxahexacosan-26-yl)oxy)pyrrolidine-2,5-dione, 1-[(26-Oxo-2,5,8,11,14,17,20,23-octaoxahexacosan-26-yl)oxy]pyrrolidine-2,5-dione, m-PEG8-NHS ester, MeO-dPEG(8)-NHS, Methyl-PEG8-NHS Ester, mPEG7-CH2CH2COONHS Ester, mPEG7-SPA, mPEG7-CH2CH2COONHS, 4,7,10,13,16,19,22,25-Octaoxahexacosanoic acid, 2,5-dioxo-1-pyrrolidinyl ester, 2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic acid succinimidyl ester