CAS 405518-55-0 appears in our catalog under these names: m-PEG9-CH2COOH/ 99.76% (existing batch purity), m–PEG9–CH2COOH, mPEG9-CH2COOH, m-PEG9-CH2COOH 98%, 3,6,9,12,15,18,21,24,27,30-Decaoxahentriacontanoic acid, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 1g, 250mg, 1000mg.
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 405518-55-0) is a chemical compound with the molecular formula C21H42O12 and a molecular weight of 486.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: XVVLEAQJQOTYFV-UHFFFAOYSA-N.
| Molecular formula | C21H42O12 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | XVVLEAQJQOTYFV-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)