CAS 468747-17-3 appears in our catalog under these names: mTOR inhibitor-1/ 100%, mTOR inhibitor–1, mTOR Inhibitor-1, >98.0%(HPLC), mTOR inhibitor-1 98%, 3-Bromo-N'-(1-(2,4-dihydroxyphenyl)ethylidene)-4-methylbenzohydrazide, 98%, 98%. Offered by: TargetMol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
3-bromo-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylbenzamide (CAS 468747-17-3) is a chemical compound with the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. IUPAC name: 3-bromo-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylbenzamide. InChIKey: NKMSVTGHOVMMHV-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O3 |
|---|---|
| Molecular weight | 363.21 g/mol |
| IUPAC name | 3-bromo-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]-4-methylbenzamide |
| InChIKey | NKMSVTGHOVMMHV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NN=C(C)C2=C(C=C(C=C2)O)O)Br |
Computed by PubChem (NCBI)