cas: 1393477-19-4 — see every product listed under this CAS number, including other names
methyl 5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%, 95% (CAS 1393477-19-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ASR-100mg |
| cas | 1393477-19-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 813.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1393477-19-4) is a chemical compound with the molecular formula C14H18BNO6 and a molecular weight of 307.11 g/mol. IUPAC name: methyl 5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: ULTODKVHKCAZQT-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO6 |
|---|---|
| Molecular weight | 307.11 g/mol |
| IUPAC name | methyl 5-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | ULTODKVHKCAZQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)