cas: 1083196-30-8 — see every product listed under this CAS number, including other names
methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate, 97%, 97% (CAS 1083196-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JPB0-100mg |
| cas | 1083196-30-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1202.00 Pln | |
| Chemat | 250mg | 1960.40 Pln | |
| Chemat | 500mg | 3227.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate (CAS 1083196-30-8) is a chemical compound with the molecular formula C9H6N2O5 and a molecular weight of 222.15 g/mol. IUPAC name: methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate. InChIKey: LLMSASCUQOAXNG-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O5 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate |
| InChIKey | LLMSASCUQOAXNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)