cas: 1083196-30-8 — see every product listed under this CAS number, including other names
methyl 5-nitrofuro(2,3-b)pyridine-2-carboxylate, 97% (CAS 1083196-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A696830-250mg |
| cas | 1083196-30-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 4809.28 Pln | |
| AmBeed | 5g | 22724.80 Pln | |
| AmBeed | 1g | 11918.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate (CAS 1083196-30-8) is a chemical compound with the molecular formula C9H6N2O5 and a molecular weight of 222.15 g/mol. IUPAC name: methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate. InChIKey: LLMSASCUQOAXNG-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O5 |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | methyl 5-nitrofuro[2,3-b]pyridine-2-carboxylate |
| InChIKey | LLMSASCUQOAXNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)