cas: 1073353-63-5 — see every product listed under this CAS number, including other names
n-(Furan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97% (CAS 1073353-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694040-100MG |
| cas | 1073353-63-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 299.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-(furan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073353-63-5) is a chemical compound with the molecular formula C18H22BNO4 and a molecular weight of 327.2 g/mol. IUPAC name: N-(furan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: CWNRULQRLNZAGF-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO4 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | CWNRULQRLNZAGF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCC3=CC=CO3 |
Computed by PubChem (NCBI)