Products 2415085-45-7
CAS 2415085-45-7 is the registry number for PDE4-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(4S)-2-hydroxyoxaborolan-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine (CAS 2415085-45-7) is a chemical compound with the molecular formula C18H22BNO4 and a molecular weight of 327.2 g/mol. IUPAC name: 3-[(4S)-2-hydroxyoxaborolan-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine. InChIKey: KXVKOYCGACSUPP-MRXNPFEDSA-N.
| Molecular formula | C18H22BNO4 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 3-[(4S)-2-hydroxyoxaborolan-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine |
| InChIKey | KXVKOYCGACSUPP-MRXNPFEDSA-N |
| SMILES | B1(C[C@H](CO1)C2=CN=CC(=C2)C3=CC(=C(C=C3)OC)OCCC)O |
Computed by PubChem (NCBI)