Products 51660-44-7

CAS 51660-44-7 is the registry number for Dipropylacetic anhydride, 95%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-propylpentanoyl 2-propylpentanoate (CAS 51660-44-7) is a chemical compound with the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. IUPAC name: 2-propylpentanoyl 2-propylpentanoate. InChIKey: GYIUDLLQLVWKPP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30O3
Molecular weight270.41 g/mol
IUPAC name2-propylpentanoyl 2-propylpentanoate
InChIKeyGYIUDLLQLVWKPP-UHFFFAOYSA-N
SMILESCCCC(CCC)C(=O)OC(=O)C(CCC)CCC

Computed by PubChem (NCBI)