cas: 19158-51-1 — see every product listed under this CAS number, including other names
p-Toluenesulfonyl cyanide, 95% (CAS 19158-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 455820010 |
| cas | 19158-51-1 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 226.29 Pln | |
| Thermo Scientific (Acros) | 5g | 761.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
(4-methylphenyl)sulfonylformonitrile (CAS 19158-51-1) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: (4-methylphenyl)sulfonylformonitrile. InChIKey: JONIMGVUGJVFQD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | (4-methylphenyl)sulfonylformonitrile |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#N |
Computed by PubChem (NCBI)