CAS 146949-21-5 appears in our catalog under these names: Pocapavir (SCH–48973), pocapavir/ 98.21% (existing batch purity), Pocapavir, 1,3-Dichloro-2-((4-((2-chloro-4-methoxyphenoxy)methyl)benzyl)oxy)benzene, 98%, 98%, Pocapavir, 99.59%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 100 mg.
1,3-dichloro-2-[[4-[(2-chloro-4-methoxyphenoxy)methyl]phenyl]methoxy]benzene (CAS 146949-21-5) is a chemical compound with the molecular formula C21H17Cl3O3 and a molecular weight of 423.7 g/mol. IUPAC name: 1,3-dichloro-2-[[4-[(2-chloro-4-methoxyphenoxy)methyl]phenyl]methoxy]benzene. InChIKey: XXMDDBVNWRWNCW-UHFFFAOYSA-N.
| Molecular formula | C21H17Cl3O3 |
|---|---|
| Molecular weight | 423.7 g/mol |
| IUPAC name | 1,3-dichloro-2-[[4-[(2-chloro-4-methoxyphenoxy)methyl]phenyl]methoxy]benzene |
| InChIKey | XXMDDBVNWRWNCW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OCC2=CC=C(C=C2)COC3=C(C=CC=C3Cl)Cl)Cl |
Computed by PubChem (NCBI)