CAS 1000000-27-0 is the registry number for 4,7-Bis(5-bromo-2-thienyl)-5,6-dinitro-2,1,3-benzothiadiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,7-bis(5-bromothiophen-2-yl)-5,6-dinitro-2,1,3-benzothiadiazole (CAS 1000000-27-0) is a chemical compound with the molecular formula C14H4Br2N4O4S3 and a molecular weight of 548.2 g/mol. IUPAC name: 4,7-bis(5-bromothiophen-2-yl)-5,6-dinitro-2,1,3-benzothiadiazole. InChIKey: AYCNHQHHAXSGTM-UHFFFAOYSA-N.
| Molecular formula | C14H4Br2N4O4S3 |
|---|---|
| Molecular weight | 548.2 g/mol |
| IUPAC name | 4,7-bis(5-bromothiophen-2-yl)-5,6-dinitro-2,1,3-benzothiadiazole |
| InChIKey | AYCNHQHHAXSGTM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=C(C(=C(C3=NSN=C23)C4=CC=C(S4)Br)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)