CAS 1000029-07-1 is the registry number for 5-Iodo-2-phenyl-1,3-thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-iodo-2-phenyl-1,3-thiazole (CAS 1000029-07-1) is a chemical compound with the molecular formula C9H6INS and a molecular weight of 287.12 g/mol. IUPAC name: 5-iodo-2-phenyl-1,3-thiazole. InChIKey: KYBZIVOEYAIDAI-UHFFFAOYSA-N.
| Molecular formula | C9H6INS |
|---|---|
| Molecular weight | 287.12 g/mol |
| IUPAC name | 5-iodo-2-phenyl-1,3-thiazole |
| InChIKey | KYBZIVOEYAIDAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)I |
Computed by PubChem (NCBI)