CAS 1000160-73-5 is the registry number for Potassium benzothiophene-3-trifluoroborate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Potassium 1-benzothiophen-3-yl(trifluoro)boranuide (CAS 1000160-73-5) is a chemical compound with the molecular formula C8H5BF3KS and a molecular weight of 240.10 g/mol. IUPAC name: potassium 1-benzothiophen-3-yl(trifluoro)boranuide. InChIKey: CMEOIXLPVLKJDC-UHFFFAOYSA-N.
| Molecular formula | C8H5BF3KS |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | potassium 1-benzothiophen-3-yl(trifluoro)boranuide |
| InChIKey | CMEOIXLPVLKJDC-UHFFFAOYSA-N |
| SMILES | [B-](C1=CSC2=CC=CC=C12)(F)(F)F.[K+] |
Computed by PubChem (NCBI)