Products 1000308-09-7
CAS 1000308-09-7 appears in our catalog under these names: (Iso)-Landipirdine/ 97.27% (existing batch purity), (Iso)-Landipirdine, (S)-Landipirdine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
[(1S)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea (CAS 1000308-09-7) is a chemical compound with the molecular formula C18H19FN2O3S and a molecular weight of 362.4 g/mol. IUPAC name: [(1S)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea. InChIKey: MTTHRRVVGMPYQG-CYBMUJFWSA-N.
| Molecular formula | C18H19FN2O3S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | [(1S)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea |
| InChIKey | MTTHRRVVGMPYQG-CYBMUJFWSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)S(=O)(=O)C3=CC=CC(=C3)F)CNC(=O)N |
Computed by PubChem (NCBI)