Products 1000342-79-9
CAS 1000342-79-9 appears in our catalog under these names: 1,7-Dihydro-dipyrrolo[2,3-b:3',2'-e]pyridine, 98%, 1,7-Dihydrodipyrrolo[2,3-b:3',2'-e]pyridine, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene (CAS 1000342-79-9) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene. InChIKey: QJPFMKGKFINTDT-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
| InChIKey | QJPFMKGKFINTDT-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC3=C(C=CN3)C=C21 |
Computed by PubChem (NCBI)