CAS 1000575-46-1 is the registry number for 2-(2,4,5-Trichlorophenyl)-1h-indole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,4,5-trichlorophenyl)-1H-indole (CAS 1000575-46-1) is a chemical compound with the molecular formula C14H8Cl3N and a molecular weight of 296.6 g/mol. IUPAC name: 2-(2,4,5-trichlorophenyl)-1H-indole. InChIKey: RRTIMMVYQSHCBO-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl3N |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-(2,4,5-trichlorophenyl)-1H-indole |
| InChIKey | RRTIMMVYQSHCBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC(=C(C=C3Cl)Cl)Cl |
Computed by PubChem (NCBI)