CAS 1000577-88-7 is the registry number for 2-Amino-5-bromo-6-fluoro-3-iodobenzonitrile, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-5-bromo-6-fluoro-3-iodobenzonitrile (CAS 1000577-88-7) is a chemical compound with the molecular formula C7H3BrFIN2 and a molecular weight of 340.92 g/mol. IUPAC name: 2-amino-5-bromo-6-fluoro-3-iodobenzonitrile. InChIKey: DTXQKEMULUBLLM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFIN2 |
|---|---|
| Molecular weight | 340.92 g/mol |
| IUPAC name | 2-amino-5-bromo-6-fluoro-3-iodobenzonitrile |
| InChIKey | DTXQKEMULUBLLM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)N)C#N)F)Br |
Computed by PubChem (NCBI)