CAS 1000578-21-1 is the registry number for 2,6-Dibromo-4-trifluoromethoxyphenyl isothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibromo-2-isothiocyanato-5-(trifluoromethoxy)benzene (CAS 1000578-21-1) is a chemical compound with the molecular formula C8H2Br2F3NOS and a molecular weight of 376.98 g/mol. IUPAC name: 1,3-dibromo-2-isothiocyanato-5-(trifluoromethoxy)benzene. InChIKey: HCIDHLJKBHKHMV-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2F3NOS |
|---|---|
| Molecular weight | 376.98 g/mol |
| IUPAC name | 1,3-dibromo-2-isothiocyanato-5-(trifluoromethoxy)benzene |
| InChIKey | HCIDHLJKBHKHMV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N=C=S)Br)OC(F)(F)F |
Computed by PubChem (NCBI)