CAS 1000578-25-5 appears in our catalog under these names: 4-Chloro-3,5-dibromo-tert-butylbenzene, 95%, 1,3-Dibromo-5-(tert-butyl)-2-chlorobenzene 97%, 1,3-dibromo-5-(tert-butyl)-2-chlorobenzene, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 100g, 500g, 10g.
1,3-dibromo-5-tert-butyl-2-chlorobenzene (CAS 1000578-25-5) is a chemical compound with the molecular formula C10H11Br2Cl and a molecular weight of 326.45 g/mol. IUPAC name: 1,3-dibromo-5-tert-butyl-2-chlorobenzene. InChIKey: WMMPUKCLMBOGTC-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2Cl |
|---|---|
| Molecular weight | 326.45 g/mol |
| IUPAC name | 1,3-dibromo-5-tert-butyl-2-chlorobenzene |
| InChIKey | WMMPUKCLMBOGTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)Cl)Br |
Computed by PubChem (NCBI)