CAS 100061-59-4 is the registry number for 2,6-Diamino-4-(benzyloxy)pyrimidine. Offered by: TRC. Available pack sizes: 10g, 1g.
6-phenylmethoxypyrimidine-2,4-diamine (CAS 100061-59-4) is a chemical compound with the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. IUPAC name: 6-phenylmethoxypyrimidine-2,4-diamine. InChIKey: MVIHQMTVQZOYCE-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 6-phenylmethoxypyrimidine-2,4-diamine |
| InChIKey | MVIHQMTVQZOYCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC(=C2)N)N |
Computed by PubChem (NCBI)