CAS 100077-38-1 appears in our catalog under these names: Triphenylene–2,3,6,7,10,11–hexathiol, 2,3,6,7,10,11-Triphenylenehexathiol, Triphenylene-2,3,6,7,10,11-hexathiol 98%, Triphenylene-2,3,6,7,10,11-hexathiol, 98%, 98%, Triphenylene-2,3,6,7,10,11-hexathiol, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 0,025g, 0,01g, 0,05g, 0,1g, 0,25g.
Triphenylene-2,3,6,7,10,11-hexathiol (CAS 100077-38-1) is a chemical compound with the molecular formula C18H12S6 and a molecular weight of 420.7 g/mol. IUPAC name: triphenylene-2,3,6,7,10,11-hexathiol. InChIKey: HBSGIZZPDDQYBQ-UHFFFAOYSA-N.
| Molecular formula | C18H12S6 |
|---|---|
| Molecular weight | 420.7 g/mol |
| IUPAC name | triphenylene-2,3,6,7,10,11-hexathiol |
| InChIKey | HBSGIZZPDDQYBQ-UHFFFAOYSA-N |
| SMILES | C1=C2C3=CC(=C(C=C3C4=CC(=C(C=C4C2=CC(=C1S)S)S)S)S)S |
Computed by PubChem (NCBI)