CAS 100080-82-8 appears in our catalog under these names: rac–Ethylenebis(1–indenyl)zirconium dichloride, DICHLORO(RAC-ETHYLENEBIS(INDENYL))-. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 250mg.
Dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene (CAS 100080-82-8) is a chemical compound with the molecular formula C20H18Cl2Zr and a molecular weight of 420.5 g/mol. IUPAC name: dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene. InChIKey: IJSDUKZKUCXMRL-UHFFFAOYSA-L.
| Molecular formula | C20H18Cl2Zr |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | dichlorozirconium;1-[2-(1H-inden-1-yl)ethyl]-1H-indene |
| InChIKey | IJSDUKZKUCXMRL-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(C=CC2=C1)CCC3C=CC4=CC=CC=C34.Cl[Zr]Cl |
Computed by PubChem (NCBI)