CAS 1000922-19-9 is the registry number for Rel-(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-amine (CAS 1000922-19-9) is a chemical compound with the molecular formula C6H12N2 and a molecular weight of 112.17 g/mol. IUPAC name: (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-amine. InChIKey: WCHKDACUFTZUMH-KVQBGUIXSA-N.
| Molecular formula | C6H12N2 |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-amine |
| InChIKey | WCHKDACUFTZUMH-KVQBGUIXSA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1N2)N |
Computed by PubChem (NCBI)