CAS 1000932-45-5 is the registry number for 5-{((difluoromethyl)sulfanyl)methyl}furan-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-(difluoromethylsulfanylmethyl)furan-2-carboxylic acid (CAS 1000932-45-5) is a chemical compound with the molecular formula C7H6F2O3S and a molecular weight of 208.18 g/mol. IUPAC name: 5-(difluoromethylsulfanylmethyl)furan-2-carboxylic acid. InChIKey: QUJDUFZQRQXIQK-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O3S |
|---|---|
| Molecular weight | 208.18 g/mol |
| IUPAC name | 5-(difluoromethylsulfanylmethyl)furan-2-carboxylic acid |
| InChIKey | QUJDUFZQRQXIQK-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CSC(F)F |
Computed by PubChem (NCBI)