CAS 1000933-13-0 appears in our catalog under these names: N-{3-((5-sulfanyl-1,3,4-thiadiazol-2-yl)amino)phenyl}acetamide, 95%, N-{3-((5-Sulfanyl-1,3,4-thiadiazol-2-yl)amino)phenyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]phenyl]acetamide (CAS 1000933-13-0) is a chemical compound with the molecular formula C10H10N4OS2 and a molecular weight of 266.3 g/mol. IUPAC name: N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]phenyl]acetamide. InChIKey: VYXZRWHKPSCGKQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N4OS2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]phenyl]acetamide |
| InChIKey | VYXZRWHKPSCGKQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)