Products 1001057-04-0
CAS 1001057-04-0 is the registry number for 2-Bromo-5-nitrobenzylamine, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
(2-bromo-5-nitrophenyl)methanamine (CAS 1001057-04-0) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: (2-bromo-5-nitrophenyl)methanamine. InChIKey: QPHPPTFIWCHIGZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | (2-bromo-5-nitrophenyl)methanamine |
| InChIKey | QPHPPTFIWCHIGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CN)Br |
Computed by PubChem (NCBI)