CAS 1001094-89-8 appears in our catalog under these names: (S)-4-(1-Aminoethyl)phenol hydrobromide, (S)-4-(1-Aminoethyl)phenol hydrobromide, 97%, 97%, 4-[(1S)-1-Aminoethyl]phenol hydrobromide, 97%, (S)-4-(1-Aminoethyl)phenol hydrobromide, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g.
4-[(1S)-1-aminoethyl]phenol;hydrobromide (CAS 1001094-89-8) is a chemical compound with the molecular formula C8H12BrNO and a molecular weight of 218.09 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]phenol;hydrobromide. InChIKey: PZBBMKOZPQAHRA-RGMNGODLSA-N.
| Molecular formula | C8H12BrNO |
|---|---|
| Molecular weight | 218.09 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]phenol;hydrobromide |
| InChIKey | PZBBMKOZPQAHRA-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)O)N.Br |
Computed by PubChem (NCBI)