CAS 100124-07-0 appears in our catalog under these names: Phenoxathiin-4-boronic acid, 95%, Phenoxathiin-4-boronic acid/ 95+%, Phenoxathiin-4-Ylboronic Acid, 97%, 97%, Phenoxathiin-4-boronic acid, 97%, Phenoxathiin-4-ylboronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g, 10g.
Phenoxathiin-4-ylboronic acid (CAS 100124-07-0) is a chemical compound with the molecular formula C12H9BO3S and a molecular weight of 244.08 g/mol. IUPAC name: phenoxathiin-4-ylboronic acid. InChIKey: IIENVBUXFRSCLM-UHFFFAOYSA-N.
| Molecular formula | C12H9BO3S |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | phenoxathiin-4-ylboronic acid |
| InChIKey | IIENVBUXFRSCLM-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)SC3=CC=CC=C3O2)(O)O |
Computed by PubChem (NCBI)