CAS 1001242-99-4 is the registry number for 8H-Imidazo[4,5-g]quinazolin-8-one, 6-amino-3,7-dihydro-2-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one (CAS 1001242-99-4) is a chemical compound with the molecular formula C10H9N5O and a molecular weight of 215.21 g/mol. IUPAC name: 6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one. InChIKey: PLJNUNPYZVVIRA-UHFFFAOYSA-N.
| Molecular formula | C10H9N5O |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
| InChIKey | PLJNUNPYZVVIRA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C3C(=C2)N=C(NC3=O)N |
Computed by PubChem (NCBI)