CAS 100125-05-1 appears in our catalog under these names: 1-Bromo 3,6-dichloro carbazole, 1-Bromo-3,6-dichlorocarbazole, 98%, 1-Bromo-3,6-dichlorocarbazole, 98%, 98%. Offered by: Chemat Brand, Fluorochem, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
1-bromo-3,6-dichloro-9H-carbazole (CAS 100125-05-1) is a chemical compound with the molecular formula C12H6BrCl2N and a molecular weight of 314.99 g/mol. IUPAC name: 1-bromo-3,6-dichloro-9H-carbazole. InChIKey: AAXKJEWUYLSARD-UHFFFAOYSA-N.
| Molecular formula | C12H6BrCl2N |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 1-bromo-3,6-dichloro-9H-carbazole |
| InChIKey | AAXKJEWUYLSARD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(N2)C(=CC(=C3)Cl)Br |
Computed by PubChem (NCBI)